CAS 447438-06-4 is the registry number for Methyl 5-Chloro-2-methoxy-4-trifluoroacetamidobenzoate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Methyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate (CAS 447438-06-4) is a chemical compound with the molecular formula C11H9ClF3NO4 and a molecular weight of 311.64 g/mol. IUPAC name: methyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate. InChIKey: HEXVTXQYKCOVAT-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF3NO4 |
|---|---|
| Molecular weight | 311.64 g/mol |
| IUPAC name | methyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate |
| InChIKey | HEXVTXQYKCOVAT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)