Products 447438-06-4

CAS 447438-06-4 is the registry number for Methyl 5-Chloro-2-methoxy-4-trifluoroacetamidobenzoate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate (CAS 447438-06-4) is a chemical compound with the molecular formula C11H9ClF3NO4 and a molecular weight of 311.64 g/mol. IUPAC name: methyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate. InChIKey: HEXVTXQYKCOVAT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClF3NO4
Molecular weight311.64 g/mol
IUPAC namemethyl 5-chloro-2-methoxy-4-[(2,2,2-trifluoroacetyl)amino]benzoate
InChIKeyHEXVTXQYKCOVAT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)Cl)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)