CAS 4479-70-3 appears in our catalog under these names: Carbonic anhydrase inhibitor 16, Carbonic anhydrase inhibitor 16, 98.00%, Carbonic anhydrase inhibitor 16, 95+%. Offered by: GLPBio, MedChemExpress, Ambeed. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 50 mg, 10mM/1mL, 100 mg.
4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (CAS 4479-70-3) is a chemical compound with the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide. InChIKey: OUGLLSMFRGBCIL-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| InChIKey | OUGLLSMFRGBCIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)