CAS 851278-26-7 appears in our catalog under these names: 2-((Benzo[d][1,3]dioxol-5-yloxy)methyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole, ≥98%, ≥98%, 2-((Benzo[d][1,3]dioxol-5-yloxy)methyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
2-(1,3-benzodioxol-5-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole (CAS 851278-26-7) is a chemical compound with the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole. InChIKey: OYWLLJQPZPCDEH-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole |
| InChIKey | OYWLLJQPZPCDEH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)OCC3=NN=C(O3)C4=CC=CS4 |
Computed by PubChem (NCBI)