CAS 449-85-4 appears in our catalog under these names: 3-Methyl-6-(trifluoromethyl)-3,4-dihydro-2H-benzo(b)(1,4)oxazine, 95%, 3-Methyl-6-(trifluoromethyl)-3,4-dihydro-2H-benzo(b)(1,4)oxazine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine (CAS 449-85-4) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: 3-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: WABCIIFXOCZRCM-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | 3-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | WABCIIFXOCZRCM-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(N1)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)