CAS 449157-34-0 is the registry number for N-(2-Chloro-4,6-dimethylphenyl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloro-4,6-dimethylphenyl)benzamide (CAS 449157-34-0) is a chemical compound with the molecular formula C15H14ClNO and a molecular weight of 259.73 g/mol. IUPAC name: N-(2-chloro-4,6-dimethylphenyl)benzamide. InChIKey: RBWJSJPDWYPQAR-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | N-(2-chloro-4,6-dimethylphenyl)benzamide |
| InChIKey | RBWJSJPDWYPQAR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)NC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)