Products 452350-43-5
CAS 452350-43-5 is the registry number for BRD-K20733377, 99.50%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 5 mg, 50 mg, 250 mg, 100 mg, 25 mg, 10 mg.
4-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (CAS 452350-43-5) is a chemical compound with the molecular formula C23H18N4O3S and a molecular weight of 430.5 g/mol. IUPAC name: 4-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide. InChIKey: HZVPVBVSVMMXDY-UHFFFAOYSA-N.
| Molecular formula | C23H18N4O3S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 4-phenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| InChIKey | HZVPVBVSVMMXDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC3=CC=C(C=C3)S(=O)(=O)NC4=NC=CC=N4 |
Computed by PubChem (NCBI)