Products 556055-08-4
CAS 556055-08-4 appears in our catalog under these names: Insecticidal agent 364, Antiparasitic agent–23, Insecticidal agent 364, ≥98%, ≥98%, Antiparasitic agent-23, 98.77%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 25 mg.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (CAS 556055-08-4) is a chemical compound with the molecular formula C23H18N4O3S and a molecular weight of 430.5 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone. InChIKey: OIMPJDPLMOKBGE-UHFFFAOYSA-N.
| Molecular formula | C23H18N4O3S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| InChIKey | OIMPJDPLMOKBGE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CSC3=NN=C(N3C4=CC=CC=C4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)