Products 45266-20-4

CAS 45266-20-4 is the registry number for 2,9-Dibutyldecanedioic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,9-dibutyldecanedioic acid (CAS 45266-20-4) is a chemical compound with the molecular formula C18H34O4 and a molecular weight of 314.5 g/mol. IUPAC name: 2,9-dibutyldecanedioic acid. InChIKey: GJBZTLMZPJRAHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H34O4
Molecular weight314.5 g/mol
IUPAC name2,9-dibutyldecanedioic acid
InChIKeyGJBZTLMZPJRAHZ-UHFFFAOYSA-N
SMILESCCCCC(CCCCCCC(CCCC)C(=O)O)C(=O)O

Computed by PubChem (NCBI)