Products 627-86-1
CAS 627-86-1 appears in our catalog under these names: Dioctanoylglycol, 97%, Dioctanoylglycol, >95% (HPLC), Dioctanoylglycol/ 98.01% (existing batch purity), Dioctanoylglycol, Dioctanoylglycol 97%. Offered by: AmBeed, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 100mg, 250mg, 25mg, 50mg, 500mg, 50 mg.
2-octanoyloxyethyl octanoate (CAS 627-86-1) is a chemical compound with the molecular formula C18H34O4 and a molecular weight of 314.5 g/mol. IUPAC name: 2-octanoyloxyethyl octanoate. InChIKey: HTNFLUQQANUSLR-UHFFFAOYSA-N.
| Molecular formula | C18H34O4 |
|---|---|
| Molecular weight | 314.5 g/mol |
| IUPAC name | 2-octanoyloxyethyl octanoate |
| InChIKey | HTNFLUQQANUSLR-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCOC(=O)CCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Dolegl, Dioctanoyl ethylene glycol, dioctanoylglycol, 2-octanoyloxyethyl octanoate, Ethylene glycol dioctanoate, ethane-1,2-diyl dioctanoate, 1,2-Dioctanoylethylene glycol, Ethylenedioctanoate, Octanoic acid,1,1'-(1,2-ethanediyl) ester, Ethylene glycol dicaprylate; Ethylene glycol dioctanoate; NSC 97300