CAS 453510-41-3 is the registry number for Rosuvastatin Impurity 178. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate (CAS 453510-41-3) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate. InChIKey: RSMQFWXHBFNAHP-JGVFFNPUSA-N.
| Molecular formula | C10H18O4 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate |
| InChIKey | RSMQFWXHBFNAHP-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](CO1)O |
Computed by PubChem (NCBI)