Products 453510-41-3

CAS 453510-41-3 is the registry number for Rosuvastatin Impurity 178. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate (CAS 453510-41-3) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate. InChIKey: RSMQFWXHBFNAHP-JGVFFNPUSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC nametert-butyl 2-[(2R,4S)-4-hydroxyoxolan-2-yl]acetate
InChIKeyRSMQFWXHBFNAHP-JGVFFNPUSA-N
SMILESCC(C)(C)OC(=O)C[C@H]1C[C@@H](CO1)O

Computed by PubChem (NCBI)