CAS 4539-78-0 appears in our catalog under these names: Benzyl (2S,3R,4S,5R)–3,4,5–tris(benzyloxy)–2–hydroxy–6–oxohexanoate, 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester, Benzyl 2,3,4-Tri-O-benzyl-D-glucuronate. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 500mg, Get quote.
Benzyl (2S,3R,4S,5R)-2-hydroxy-6-oxo-3,4,5-tris(phenylmethoxy)hexanoate (CAS 4539-78-0) is a chemical compound with the molecular formula C34H34O7 and a molecular weight of 554.6 g/mol. IUPAC name: benzyl (2S,3R,4S,5R)-2-hydroxy-6-oxo-3,4,5-tris(phenylmethoxy)hexanoate. InChIKey: PHIFEAMPNRVWOH-UYEZAFAQSA-N.
| Molecular formula | C34H34O7 |
|---|---|
| Molecular weight | 554.6 g/mol |
| IUPAC name | benzyl (2S,3R,4S,5R)-2-hydroxy-6-oxo-3,4,5-tris(phenylmethoxy)hexanoate |
| InChIKey | PHIFEAMPNRVWOH-UYEZAFAQSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H](C=O)[C@H]([C@@H]([C@@H](C(=O)OCC2=CC=CC=C2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)