CAS 53684-90-5 appears in our catalog under these names: Benzyl 2,3,4-Tri-O-benzyl-D-glucuronate, >95% (HPLC), 2,3,4-Tri-O-benzyl-D-glucuronide benzyl ester. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 10mg, 50mg, 100mg.
Benzyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate (CAS 53684-90-5) is a chemical compound with the molecular formula C34H34O7 and a molecular weight of 554.6 g/mol. IUPAC name: benzyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate. InChIKey: JGZVCCVFRMQHQJ-NVUQYOTJSA-N.
| Molecular formula | C34H34O7 |
|---|---|
| Molecular weight | 554.6 g/mol |
| IUPAC name | benzyl (2S,3S,4S,5R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxane-2-carboxylate |
| InChIKey | JGZVCCVFRMQHQJ-NVUQYOTJSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H](OC([C@@H]2OCC3=CC=CC=C3)O)C(=O)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)