CAS 454-05-7 is the registry number for 3'-Trifluoromethylacetophenone semicarbazone, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]urea (CAS 454-05-7) is a chemical compound with the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. IUPAC name: [(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]urea. InChIKey: DZATUGRJMFZZBW-GIDUJCDVSA-N.
| Molecular formula | C10H10F3N3O |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | [(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]urea |
| InChIKey | DZATUGRJMFZZBW-GIDUJCDVSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)