Products 52376-84-8
CAS 52376-84-8 is the registry number for ({1-[4-(trifluoromethyl)phenyl]ethylidene}amino)urea, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]urea (CAS 52376-84-8) is a chemical compound with the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. IUPAC name: [(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]urea. InChIKey: GYWCIJPQRFUBNU-GIDUJCDVSA-N.
| Molecular formula | C10H10F3N3O |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | [(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]urea |
| InChIKey | GYWCIJPQRFUBNU-GIDUJCDVSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)