CAS 454-68-2 appears in our catalog under these names: 5-(Trifluoromethyl)benzene-1,3-diol, 95%, 5-(Trifluoromethyl)benzene-1,3-diol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-(trifluoromethyl)benzene-1,3-diol (CAS 454-68-2) is a chemical compound with the molecular formula C7H5F3O2 and a molecular weight of 178.11 g/mol. IUPAC name: 5-(trifluoromethyl)benzene-1,3-diol. InChIKey: LXCRBEFECXIJJV-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2 |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 5-(trifluoromethyl)benzene-1,3-diol |
| InChIKey | LXCRBEFECXIJJV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)O)C(F)(F)F |
Computed by PubChem (NCBI)