CAS 577-10-6 appears in our catalog under these names: 2,5-Dihydroxybenzotrifluoride, 95%, 2-(Trifluoromethyl)benzene-1,4-diol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(trifluoromethyl)benzene-1,4-diol (CAS 577-10-6) is a chemical compound with the molecular formula C7H5F3O2 and a molecular weight of 178.11 g/mol. IUPAC name: 2-(trifluoromethyl)benzene-1,4-diol. InChIKey: GTXDKCFFLZJGRZ-UHFFFAOYSA-N.
| Molecular formula | C7H5F3O2 |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 2-(trifluoromethyl)benzene-1,4-diol |
| InChIKey | GTXDKCFFLZJGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(F)(F)F)O |
Computed by PubChem (NCBI)