CAS 457657-34-0 appears in our catalog under these names: PA 452, PA 452, PA452/ 96.76% (existing batch purity), PA452 99%, 2-((3-(Hexyloxy)-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)(methyl)amino)pyrimidine-5-carboxylic acid, 99%, 99%. Offered by: TRC, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 50mg, 10mg, 1mg, 5mg, 25mg, 100mg, 200mg, 50 mg.
2-[(3-hexoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-methylamino]pyrimidine-5-carboxylic acid (CAS 457657-34-0) is a chemical compound with the molecular formula C26H37N3O3 and a molecular weight of 439.6 g/mol. IUPAC name: 2-[(3-hexoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-methylamino]pyrimidine-5-carboxylic acid. InChIKey: JJUUTJCZMGZJDZ-UHFFFAOYSA-N.
| Molecular formula | C26H37N3O3 |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | 2-[(3-hexoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-methylamino]pyrimidine-5-carboxylic acid |
| InChIKey | JJUUTJCZMGZJDZ-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=C(C=C2C(=C1)C(CCC2(C)C)(C)C)N(C)C3=NC=C(C=N3)C(=O)O |
Computed by PubChem (NCBI)