Products 501926-82-5
CAS 501926-82-5 appears in our catalog under these names: MN–25, MN-25. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 10 mg, 5 mg, 1 mg.
7-methoxy-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide (CAS 501926-82-5) is a chemical compound with the molecular formula C26H37N3O3 and a molecular weight of 439.6 g/mol. IUPAC name: 7-methoxy-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide. InChIKey: VQGDMQICNRCQEH-UFKXBGGNSA-N.
| Molecular formula | C26H37N3O3 |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | 7-methoxy-1-(2-morpholin-4-ylethyl)-N-[(1S,2S,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]indole-3-carboxamide |
| InChIKey | VQGDMQICNRCQEH-UFKXBGGNSA-N |
| SMILES | C[C@]12CC[C@H](C1)C([C@H]2NC(=O)C3=CN(C4=C3C=CC=C4OC)CCN5CCOCC5)(C)C |
Computed by PubChem (NCBI)