CAS 4578-63-6 appears in our catalog under these names: 4-(tert-Butyl)-2-hydroxybenzoic acid, 98%, 4-(tert-Butyl)-2-hydroxybenzoic acid, 4-(tert-Butyl)-2-hydroxybenzoic acid, 98%, 98%, 4-tert-Butyl-2-hydroxybenzoic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10g, 1g, 250mg.
4-tert-butyl-2-hydroxybenzoic acid (CAS 4578-63-6) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-tert-butyl-2-hydroxybenzoic acid. InChIKey: DEZCCOKUEFEDGQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-tert-butyl-2-hydroxybenzoic acid |
| InChIKey | DEZCCOKUEFEDGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(=O)O)O |
Computed by PubChem (NCBI)