CAS 457922-04-2 is the registry number for 4-((4-(N-Mesitylsulfamoyl)phenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-4-[4-[(2,4,6-trimethylphenyl)sulfamoyl]anilino]butanoic acid (CAS 457922-04-2) is a chemical compound with the molecular formula C19H22N2O5S and a molecular weight of 390.5 g/mol. IUPAC name: 4-oxo-4-[4-[(2,4,6-trimethylphenyl)sulfamoyl]anilino]butanoic acid. InChIKey: FCBLYCLFJYEHDY-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O5S |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 4-oxo-4-[4-[(2,4,6-trimethylphenyl)sulfamoyl]anilino]butanoic acid |
| InChIKey | FCBLYCLFJYEHDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)CCC(=O)O)C |
Computed by PubChem (NCBI)