CAS 92535-43-8 is the registry number for MMP2-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-5-(benzylamino)-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoic acid (CAS 92535-43-8) is a chemical compound with the molecular formula C19H22N2O5S and a molecular weight of 390.5 g/mol. IUPAC name: (2R)-5-(benzylamino)-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoic acid. InChIKey: YJZSRDUHGUXYJX-QGZVFWFLSA-N.
| Molecular formula | C19H22N2O5S |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | (2R)-5-(benzylamino)-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
| InChIKey | YJZSRDUHGUXYJX-QGZVFWFLSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](CCC(=O)NCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)