CAS 45895-90-7 is the registry number for L-Isoleucine N-Carboxyanhydride. Offered by: TRC. Available pack sizes: 500mg.
(4S)-4-[(2S)-butan-2-yl]-1,3-oxazolidine-2,5-dione (CAS 45895-90-7) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. IUPAC name: (4S)-4-[(2S)-butan-2-yl]-1,3-oxazolidine-2,5-dione. InChIKey: WAACGCAWLJFFQX-WHFBIAKZSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (4S)-4-[(2S)-butan-2-yl]-1,3-oxazolidine-2,5-dione |
| InChIKey | WAACGCAWLJFFQX-WHFBIAKZSA-N |
| SMILES | CC[C@H](C)[C@H]1C(=O)OC(=O)N1 |
Computed by PubChem (NCBI)