Products 459421-23-9

CAS 459421-23-9 is the registry number for 2-[(1-Isopropyl-2,5-dioxopyrrolidin-3-yl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylbenzoic acid (CAS 459421-23-9) is a chemical compound with the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. IUPAC name: 2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylbenzoic acid. InChIKey: MRIQQRXUKPABAK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO4S
Molecular weight293.34 g/mol
IUPAC name2-(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)sulfanylbenzoic acid
InChIKeyMRIQQRXUKPABAK-UHFFFAOYSA-N
SMILESCC(C)N1C(=O)CC(C1=O)SC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)