CAS 62035-67-0 is the registry number for N-(3,4-Dimethoxyphenyl)benzenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
N-(3,4-dimethoxyphenyl)benzenesulfonamide (CAS 62035-67-0) is a chemical compound with the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)benzenesulfonamide. InChIKey: AWMVSQUGEOFWMH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO4S |
|---|---|
| Molecular weight | 293.34 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)benzenesulfonamide |
| InChIKey | AWMVSQUGEOFWMH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)