Products 459810-12-9
CAS 459810-12-9 is the registry number for (3-(Dimethylamino)-5-methoxyphenyl)boronic acid, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
[3-(dimethylamino)-5-methoxyphenyl]boronic acid (CAS 459810-12-9) is a chemical compound with the molecular formula C9H14BNO3 and a molecular weight of 195.03 g/mol. IUPAC name: [3-(dimethylamino)-5-methoxyphenyl]boronic acid. InChIKey: FIYQTTUOMQHMRZ-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO3 |
|---|---|
| Molecular weight | 195.03 g/mol |
| IUPAC name | [3-(dimethylamino)-5-methoxyphenyl]boronic acid |
| InChIKey | FIYQTTUOMQHMRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)N(C)C)(O)O |
Computed by PubChem (NCBI)