Products 46029-22-5
CAS 46029-22-5 appears in our catalog under these names: 5–Methylthiophene–2，3–dicarboxylic Acid, 5-Methylthiophene-2,3-dicarboxylic acid, 5-Methylthiophene-2,3-dicarboxylic acid, 95%, 5-methylthiophene-2,3-dicarboxylic acid, 98%, 5-Methylthiophene-2，3-dicarboxylic Acid, 98%, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 0,5g, 1g, 100mg.
5-methylthiophene-2,3-dicarboxylic acid (CAS 46029-22-5) is a chemical compound with the molecular formula C7H6O4S and a molecular weight of 186.19 g/mol. IUPAC name: 5-methylthiophene-2,3-dicarboxylic acid. InChIKey: QJPLLRMTCIBCFS-UHFFFAOYSA-N.
| Molecular formula | C7H6O4S |
|---|---|
| Molecular weight | 186.19 g/mol |
| IUPAC name | 5-methylthiophene-2,3-dicarboxylic acid |
| InChIKey | QJPLLRMTCIBCFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)