CAS 89677-40-7 appears in our catalog under these names: 3-Methylthiophene-2,5-dicarboxylic acid, 95%, 3-Methylthiophene-2,5-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-methylthiophene-2,5-dicarboxylic acid (CAS 89677-40-7) is a chemical compound with the molecular formula C7H6O4S and a molecular weight of 186.19 g/mol. IUPAC name: 3-methylthiophene-2,5-dicarboxylic acid. InChIKey: LKJFFKJAHDRBEP-UHFFFAOYSA-N.
| Molecular formula | C7H6O4S |
|---|---|
| Molecular weight | 186.19 g/mol |
| IUPAC name | 3-methylthiophene-2,5-dicarboxylic acid |
| InChIKey | LKJFFKJAHDRBEP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)