Products 4603-70-7
CAS 4603-70-7 is the registry number for 2'–Deoxyadenosine–5'–carboxylic acid. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
2-[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]-2-hydroxyacetic acid (CAS 4603-70-7) is a chemical compound with the molecular formula C11H13N5O5 and a molecular weight of 295.25 g/mol. IUPAC name: 2-[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]-2-hydroxyacetic acid. InChIKey: MXVAUNDRCBRLND-UHFFFAOYSA-N.
| Molecular formula | C11H13N5O5 |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | 2-[5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]-2-hydroxyacetic acid |
| InChIKey | MXVAUNDRCBRLND-UHFFFAOYSA-N |
| SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)C(C(=O)O)O)O |
Computed by PubChem (NCBI)