Products 460346-02-5

CAS 460346-02-5 is the registry number for P7-2104, 99.77%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 50 mg, 100 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

8-chloro-5-methoxyspiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-2-one (CAS 460346-02-5) is a chemical compound with the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. IUPAC name: 8-chloro-5-methoxyspiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-2-one. InChIKey: CVJGVQVPEASPCK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17ClN2O2
Molecular weight280.75 g/mol
IUPAC name8-chloro-5-methoxyspiro[1,3-dihydroquinazoline-4,1'-cyclohexane]-2-one
InChIKeyCVJGVQVPEASPCK-UHFFFAOYSA-N
SMILESCOC1=C2C(=C(C=C1)Cl)NC(=O)NC23CCCCC3

Computed by PubChem (NCBI)