CAS 460748-08-7 is the registry number for 4-(4-Cyanophenyl)-2-methylphenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-hydroxy-3-methylphenyl)benzonitrile (CAS 460748-08-7) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 4-(4-hydroxy-3-methylphenyl)benzonitrile. InChIKey: NENYHEMJBYIEIC-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-(4-hydroxy-3-methylphenyl)benzonitrile |
| InChIKey | NENYHEMJBYIEIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)C#N)O |
Computed by PubChem (NCBI)