Products 460751-68-2
CAS 460751-68-2 appears in our catalog under these names: Fmoc-Trp(5-Me)-OH, 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(5-methyl-1H-indol-3-yl)propanoic acid, 95%, N-FMOC-5-METHYL-L-TRYPTOPHAN, 98%, Fmoc-L-Trp(5-Me)-OH, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methyl-1H-indol-3-yl)propanoic acid (CAS 460751-68-2) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methyl-1H-indol-3-yl)propanoic acid. InChIKey: XLKFSFRZGVTQNQ-VWLOTQADSA-N.
| Molecular formula | C27H24N2O4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(5-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | XLKFSFRZGVTQNQ-VWLOTQADSA-N |
| SMILES | CC1=CC2=C(C=C1)NC=C2C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)