Products 46182-32-5

CAS 46182-32-5 is the registry number for 1-Ethyl-5-methoxy-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-ethyl-5-methoxyindole (CAS 46182-32-5) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-ethyl-5-methoxyindole. InChIKey: OUJVELDZPSZKKA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO
Molecular weight175.23 g/mol
IUPAC name1-ethyl-5-methoxyindole
InChIKeyOUJVELDZPSZKKA-UHFFFAOYSA-N
SMILESCCN1C=CC2=C1C=CC(=C2)OC

Computed by PubChem (NCBI)