Products 462075-93-0

CAS 462075-93-0 is the registry number for 4-[(Butylthio)methyl]-5-methyl-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(butylsulfanylmethyl)-5-methylfuran-2-carboxylic acid (CAS 462075-93-0) is a chemical compound with the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. IUPAC name: 4-(butylsulfanylmethyl)-5-methylfuran-2-carboxylic acid. InChIKey: GELLZSIDRRZODN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O3S
Molecular weight228.31 g/mol
IUPAC name4-(butylsulfanylmethyl)-5-methylfuran-2-carboxylic acid
InChIKeyGELLZSIDRRZODN-UHFFFAOYSA-N
SMILESCCCCSCC1=C(OC(=C1)C(=O)O)C

Computed by PubChem (NCBI)