CAS 4664-57-7 appears in our catalog under these names: tert-Butyl Tosylate, tert-Butyl Tosylate 98%, Benzenesulfonic acid, 4-methyl-, 1,1-dimethylethyl ester, 98%, 98%, TERT-BUTYL 4-METHYLBENZENESULFONATE, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g, 5g, 500mg.
Tert-butyl 4-methylbenzenesulfonate (CAS 4664-57-7) is a chemical compound with the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. IUPAC name: tert-butyl 4-methylbenzenesulfonate. InChIKey: DLRDEMODNIPHMU-UHFFFAOYSA-N.
| Molecular formula | C11H16O3S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | tert-butyl 4-methylbenzenesulfonate |
| InChIKey | DLRDEMODNIPHMU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(C)(C)C |
Computed by PubChem (NCBI)