CAS 462652-42-2 is the registry number for 3–(5–fluoro–2–pyridinyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[3-(5-fluoro-2-pyridinyl)phenyl]boronic acid (CAS 462652-42-2) is a chemical compound with the molecular formula C11H9BFNO2 and a molecular weight of 217.01 g/mol. IUPAC name: [3-(5-fluoro-2-pyridinyl)phenyl]boronic acid. InChIKey: LAFHPKNSWOAUFL-UHFFFAOYSA-N.
| Molecular formula | C11H9BFNO2 |
|---|---|
| Molecular weight | 217.01 g/mol |
| IUPAC name | [3-(5-fluoro-2-pyridinyl)phenyl]boronic acid |
| InChIKey | LAFHPKNSWOAUFL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)