Products 464152-46-3
CAS 464152-46-3 is the registry number for BCTP. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-tert-butyl-6-(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one (CAS 464152-46-3) is a chemical compound with the molecular formula C17H16ClN3OS and a molecular weight of 345.8 g/mol. IUPAC name: 7-tert-butyl-6-(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one. InChIKey: BOBBYBHJYYJHHQ-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3OS |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 7-tert-butyl-6-(4-chlorophenyl)-2-sulfanylidene-1H-pyrido[2,3-d]pyrimidin-4-one |
| InChIKey | BOBBYBHJYYJHHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C2C(=N1)NC(=S)NC2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)