CAS 554436-99-6 is the registry number for 4-({4-Chloro-5-phenylthieno(2,3-d)pyrimidin-2-yl}methyl)morpholine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[(4-chloro-5-phenylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine (CAS 554436-99-6) is a chemical compound with the molecular formula C17H16ClN3OS and a molecular weight of 345.8 g/mol. IUPAC name: 4-[(4-chloro-5-phenylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine. InChIKey: GUTWGBRZKXGUIT-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3OS |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 4-[(4-chloro-5-phenylthieno[2,3-d]pyrimidin-2-yl)methyl]morpholine |
| InChIKey | GUTWGBRZKXGUIT-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=NC3=C(C(=CS3)C4=CC=CC=C4)C(=N2)Cl |
Computed by PubChem (NCBI)