Products 4654-18-6

CAS 4654-18-6 is the registry number for Isophthalic acid, bis-n-octyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Dioctyl benzene-1,3-dicarboxylate (CAS 4654-18-6) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 390.6 g/mol. IUPAC name: dioctyl benzene-1,3-dicarboxylate. InChIKey: LERGDXJITDVDBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H38O4
Molecular weight390.6 g/mol
IUPAC namedioctyl benzene-1,3-dicarboxylate
InChIKeyLERGDXJITDVDBZ-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC(=CC=C1)C(=O)OCCCCCCCC

Computed by PubChem (NCBI)