Products 465514-17-4

CAS 465514-17-4 appears in our catalog under these names: 2-Morpholin-4-yl-pyridine-3-sulfonyl chloride, 95%, 2-Morpholinopyridine-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-morpholin-4-ylpyridine-3-sulfonyl chloride (CAS 465514-17-4) is a chemical compound with the molecular formula C9H11ClN2O3S and a molecular weight of 262.71 g/mol. IUPAC name: 2-morpholin-4-ylpyridine-3-sulfonyl chloride. InChIKey: NSLLLGGMRRRBFX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClN2O3S
Molecular weight262.71 g/mol
IUPAC name2-morpholin-4-ylpyridine-3-sulfonyl chloride
InChIKeyNSLLLGGMRRRBFX-UHFFFAOYSA-N
SMILESC1COCCN1C2=C(C=CC=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)