CAS 6125-37-7 is the registry number for Ethyl 2-[(chloroacetyl)amino]-4-methyl-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 2-[(2-chloroacetyl)amino]-4-methyl-1,3-thiazole-5-carboxylate (CAS 6125-37-7) is a chemical compound with the molecular formula C9H11ClN2O3S and a molecular weight of 262.71 g/mol. IUPAC name: ethyl 2-[(2-chloroacetyl)amino]-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: GKHLTBQFQWMXBU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3S |
|---|---|
| Molecular weight | 262.71 g/mol |
| IUPAC name | ethyl 2-[(2-chloroacetyl)amino]-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | GKHLTBQFQWMXBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)NC(=O)CCl)C |
Computed by PubChem (NCBI)