CAS 4681-16-7 is the registry number for 2,3,5-Trichlorophenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2,3,5-trichlorophenyl)acetonitrile (CAS 4681-16-7) is a chemical compound with the molecular formula C8H4Cl3N and a molecular weight of 220.5 g/mol. IUPAC name: 2-(2,3,5-trichlorophenyl)acetonitrile. InChIKey: MVGPEGIFSAFHOU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl3N |
|---|---|
| Molecular weight | 220.5 g/mol |
| IUPAC name | 2-(2,3,5-trichlorophenyl)acetonitrile |
| InChIKey | MVGPEGIFSAFHOU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CC#N)Cl)Cl)Cl |
Computed by PubChem (NCBI)