CAS 72017-35-7 is the registry number for 2-(2,4,6-trichlorophenyl)acetonitrile. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trichlorophenyl)acetonitrile (CAS 72017-35-7) is a chemical compound with the molecular formula C8H4Cl3N and a molecular weight of 220.5 g/mol. IUPAC name: 2-(2,4,6-trichlorophenyl)acetonitrile. InChIKey: KQWHNBIYSHFRLC-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl3N |
|---|---|
| Molecular weight | 220.5 g/mol |
| IUPAC name | 2-(2,4,6-trichlorophenyl)acetonitrile |
| InChIKey | KQWHNBIYSHFRLC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CC#N)Cl)Cl |
Computed by PubChem (NCBI)