CAS 4682-46-6 is the registry number for Madurose. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-3-methoxyhexanal (CAS 4682-46-6) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-3-methoxyhexanal. InChIKey: RMTFNDVZYPHUEF-JRTVQGFMSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-3-methoxyhexanal |
| InChIKey | RMTFNDVZYPHUEF-JRTVQGFMSA-N |
| SMILES | CO[C@H]([C@H](C=O)O)[C@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)