CAS 469-27-2 is the registry number for Longifolol. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2,5mg, 5mg, 25mg, 50mg.
[(1R,2S,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol (CAS 469-27-2) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: [(1R,2S,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol. InChIKey: VZJHQHUOVIDRCF-NTASLKFISA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | [(1R,2S,7S,8R,9S)-3,3,7-trimethyl-8-tricyclo[5.4.0.02,9]undecanyl]methanol |
| InChIKey | VZJHQHUOVIDRCF-NTASLKFISA-N |
| SMILES | C[C@]12CCCC([C@@H]3[C@H]1CC[C@@H]3[C@H]2CO)(C)C |
Computed by PubChem (NCBI)