CAS 46921-20-4 appears in our catalog under these names: (S)-Benzyl 2-amino-3-(1H-imidazol-4-yl)propanoate, 98%, L-Histidine Benzyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g.
Benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate (CAS 46921-20-4) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate. InChIKey: AXIQMEOYYYWDKF-LBPRGKRZSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate |
| InChIKey | AXIQMEOYYYWDKF-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CN=CN2)N |
Computed by PubChem (NCBI)