Products 4698-90-2
CAS 4698-90-2 is the registry number for 1-Amino-3-(3-(trifluoromethyl)phenoxy)propan-2-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-amino-3-[3-(trifluoromethyl)phenoxy]propan-2-ol (CAS 4698-90-2) is a chemical compound with the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. IUPAC name: 1-amino-3-[3-(trifluoromethyl)phenoxy]propan-2-ol. InChIKey: QBOZYQWTVVSEFZ-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO2 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 1-amino-3-[3-(trifluoromethyl)phenoxy]propan-2-ol |
| InChIKey | QBOZYQWTVVSEFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(CN)O)C(F)(F)F |
Computed by PubChem (NCBI)