Products 469890-14-0
CAS 469890-14-0 appears in our catalog under these names: Cevimeline N-Oxide, Cevimeline Impurity 2(Cevimeline N-Oxide), Cevimeline N-Oxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2S,5S)-2-methyl-1'-oxidospiro[1,3-oxathiolane-5,3'-1-azoniabicyclo[2.2.2]octane] (CAS 469890-14-0) is a chemical compound with the molecular formula C10H17NO2S and a molecular weight of 215.31 g/mol. IUPAC name: (2S,5S)-2-methyl-1'-oxidospiro[1,3-oxathiolane-5,3'-1-azoniabicyclo[2.2.2]octane]. InChIKey: DWWHPWWQQISZCA-XEAZBWPWSA-N.
| Molecular formula | C10H17NO2S |
|---|---|
| Molecular weight | 215.31 g/mol |
| IUPAC name | (2S,5S)-2-methyl-1'-oxidospiro[1,3-oxathiolane-5,3'-1-azoniabicyclo[2.2.2]octane] |
| InChIKey | DWWHPWWQQISZCA-XEAZBWPWSA-N |
| SMILES | C[C@H]1O[C@@]2(C[N+]3(CCC2CC3)[O-])CS1 |
Computed by PubChem (NCBI)
Synonyms:
Cevimeline N-Oxide