CAS 47017-06-1 appears in our catalog under these names: Metaraminol Impurity 26, Metaraminol Impurity 25. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2R)-2-amino-1-(3-phenylmethoxyphenyl)propan-1-ol (CAS 47017-06-1) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: (1S,2R)-2-amino-1-(3-phenylmethoxyphenyl)propan-1-ol. InChIKey: KUROJUPTEJDZJB-MLGOLLRUSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (1S,2R)-2-amino-1-(3-phenylmethoxyphenyl)propan-1-ol |
| InChIKey | KUROJUPTEJDZJB-MLGOLLRUSA-N |
| SMILES | C[C@H]([C@H](C1=CC(=CC=C1)OCC2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)