CAS 4703-95-1 is the registry number for 3-(Furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 4703-95-1) is a chemical compound with the molecular formula C8H7NO2S2 and a molecular weight of 213.3 g/mol. IUPAC name: 3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: POEGXFNVFURMLC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S2 |
|---|---|
| Molecular weight | 213.3 g/mol |
| IUPAC name | 3-(furan-2-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | POEGXFNVFURMLC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)S1)CC2=CC=CO2 |
Computed by PubChem (NCBI)