CAS 588675-85-8 is the registry number for Methyl 2-isothiocyanato-5-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-isothiocyanato-5-methylthiophene-3-carboxylate (CAS 588675-85-8) is a chemical compound with the molecular formula C8H7NO2S2 and a molecular weight of 213.3 g/mol. IUPAC name: methyl 2-isothiocyanato-5-methylthiophene-3-carboxylate. InChIKey: MOIJNRCYLJNXBP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO2S2 |
|---|---|
| Molecular weight | 213.3 g/mol |
| IUPAC name | methyl 2-isothiocyanato-5-methylthiophene-3-carboxylate |
| InChIKey | MOIJNRCYLJNXBP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)N=C=S)C(=O)OC |
Computed by PubChem (NCBI)